C7H13ClN2O3 — CID 102019018
(2S)-2-[[2-(chloroamino)acetyl]amino]-3-methylbutanoic acid (PubChem CID 102019018) has the molecular formula C7H13ClN2O3 and a molecular weight of 208.64 g/mol. Its IUPAC name is (2S)-2-[[2-(chloroamino)acetyl]amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[[2-(chloroamino)acetyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 102019018 |
| Molecular Formula | C7H13ClN2O3 |
| Molecular Weight | 208.64 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | (2S)-2-[[2-(chloroamino)acetyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](NC(=O)CNCl)C(=O)O |
| InChI | InChI=1S/C7H13ClN2O3/c1-4(2)6(7(12)13)10-5(11)3-9-8/h4,6,9H,3H2,1-2H3,(H,10,11)(H,12,13)/t6-/m0/s1 |
| InChIKey | OZGSAZBTLMHSHZ-LURJTMIESA-N |
| XLogP | -0.04 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.64 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|