C19H38N2O3 — CID 91122441
(2S)-2-[[2-(dodecylamino)acetyl]amino]-3-methylbutanoic acid (PubChem CID 91122441) has the molecular formula C19H38N2O3 and a molecular weight of 342.52 g/mol. Its IUPAC name is (2S)-2-[[2-(dodecylamino)acetyl]amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[[2-(dodecylamino)acetyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 91122441 |
| Molecular Formula | C19H38N2O3 |
| Molecular Weight | 342.52 g/mol |
| Exact Mass | 342.29 |
| IUPAC Name | (2S)-2-[[2-(dodecylamino)acetyl]amino]-3-methylbutanoic acid |
| SMILES | CCCCCCCCCCCCNCC(=O)N[C@H](C(=O)O)C(C)C |
| InChI | InChI=1S/C19H38N2O3/c1-4-5-6-7-8-9-10-11-12-13-14-20-15-17(22)21-18(16(2)3)19(23)24/h16,18,20H,4-15H2,1-3H3,(H,21,22)(H,23,24)/t18-/m0/s1 |
| InChIKey | XPURLNVZAARJHB-SFHVURJKSA-N |
| XLogP | 3.72 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.52 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|