C19H38NNaO3 — CID 174755034
sodium;hydride;(2S)-3-methyl-2-(tetradecanoylamino)butanoic acid (PubChem CID 174755034) has the molecular formula C19H38NNaO3 and a molecular weight of 351.51 g/mol. Its IUPAC name is sodium;hydride;(2S)-3-methyl-2-(tetradecanoylamino)butanoic acid.
| Compound Name | sodium;hydride;(2S)-3-methyl-2-(tetradecanoylamino)butanoic acid |
|---|---|
| PubChem CID | 174755034 |
| Molecular Formula | C19H38NNaO3 |
| Molecular Weight | 351.51 g/mol |
| Exact Mass | 351.27 |
| IUPAC Name | sodium;hydride;(2S)-3-methyl-2-(tetradecanoylamino)butanoic acid |
| SMILES | CCCCCCCCCCCCCC(=O)N[C@H](C(=O)O)C(C)C.[H-].[Na+] |
| InChI | InChI=1S/C19H37NO3.Na.H/c1-4-5-6-7-8-9-10-11-12-13-14-15-17(21)20-18(16(2)3)19(22)23;;/h16,18H,4-15H2,1-3H3,(H,20,21)(H,22,23);;/q;+1;-1/t18-;;/m0../s1 |
| InChIKey | LFLSSTIXEJUBAW-NTEVMMBTSA-N |
| XLogP | 2.03 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.51 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|