C14H21BrN2O3 — CID 82033904
3-methyl-2-(3-pyridin-1-ium-1-ylpropanoylamino)pentanoic acid bromide (PubChem CID 82033904) has the molecular formula C14H21BrN2O3 and a molecular weight of 345.24 g/mol. Its IUPAC name is 3-methyl-2-(3-pyridin-1-ium-1-ylpropanoylamino)pentanoic acid bromide.
| Compound Name | 3-methyl-2-(3-pyridin-1-ium-1-ylpropanoylamino)pentanoic acid bromide |
|---|---|
| PubChem CID | 82033904 |
| Molecular Formula | C14H21BrN2O3 |
| Molecular Weight | 345.24 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 3-methyl-2-(3-pyridin-1-ium-1-ylpropanoylamino)pentanoic acid bromide |
| SMILES | CCC(C)C(NC(=O)CC[n+]1ccccc1)C(=O)O.[Br-] |
| InChI | InChI=1S/C14H20N2O3.BrH/c1-3-11(2)13(14(18)19)15-12(17)7-10-16-8-5-4-6-9-16;/h4-6,8-9,11,13H,3,7,10H2,1-2H3,(H-,15,17,18,19);1H |
| InChIKey | UKUAROIBZYHJJX-UHFFFAOYSA-N |
| XLogP | -2.02 |
| TPSA | 70.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.24 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|