C10H18ClNO3 — CID 3503073
2-(4-chlorobutanoylamino)-3-methylpentanoic acid (PubChem CID 3503073) has the molecular formula C10H18ClNO3 and a molecular weight of 235.71 g/mol. Its IUPAC name is 2-(4-chlorobutanoylamino)-3-methylpentanoic acid.
| Compound Name | 2-(4-chlorobutanoylamino)-3-methylpentanoic acid |
|---|---|
| PubChem CID | 3503073 |
| Molecular Formula | C10H18ClNO3 |
| Molecular Weight | 235.71 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 2-(4-chlorobutanoylamino)-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)CCCCl)C(=O)O |
| InChI | InChI=1S/C10H18ClNO3/c1-3-7(2)9(10(14)15)12-8(13)5-4-6-11/h7,9H,3-6H2,1-2H3,(H,12,13)(H,14,15) |
| InChIKey | LGDYCBRZRZHANL-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.71 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|