C15H22Cl2N2O8+2 — CID 126957010
perchloric acid;1-(5-pyridin-1-ium-1-ylpentyl)pyridin-1-ium (PubChem CID 126957010) has the molecular formula C15H22Cl2N2O8+2 and a molecular weight of 429.25 g/mol. Its IUPAC name is perchloric acid;1-(5-pyridin-1-ium-1-ylpentyl)pyridin-1-ium.
| Compound Name | perchloric acid;1-(5-pyridin-1-ium-1-ylpentyl)pyridin-1-ium |
|---|---|
| PubChem CID | 126957010 |
| Molecular Formula | C15H22Cl2N2O8+2 |
| Molecular Weight | 429.25 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | perchloric acid;1-(5-pyridin-1-ium-1-ylpentyl)pyridin-1-ium |
| SMILES | [O-][Cl+3]([O-])([O-])O.[O-][Cl+3]([O-])([O-])O.c1cc[n+](CCCCC[n+]2ccccc2)cc1 |
| InChI | InChI=1S/C15H20N2.2ClHO4/c1-4-10-16(11-5-1)14-8-3-9-15-17-12-6-2-7-13-17;2*2-1(3,4)5/h1-2,4-7,10-13H,3,8-9,14-15H2;2*(H,2,3,4,5)/q+2;; |
| InChIKey | GBYKNCUDCWEQLN-UHFFFAOYSA-N |
| XLogP | -6.12 |
| TPSA | 186.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.25 |
| LogP ≤ 5 | -6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|