C13H16Cl2N2O8 — CID 45047883
1-(3-pyridin-1-ium-1-ylpropyl)pyridin-1-ium diperchlorate (PubChem CID 45047883) has the molecular formula C13H16Cl2N2O8 and a molecular weight of 399.18 g/mol. Its IUPAC name is 1-(3-pyridin-1-ium-1-ylpropyl)pyridin-1-ium diperchlorate.
| Compound Name | 1-(3-pyridin-1-ium-1-ylpropyl)pyridin-1-ium diperchlorate |
|---|---|
| PubChem CID | 45047883 |
| Molecular Formula | C13H16Cl2N2O8 |
| Molecular Weight | 399.18 g/mol |
| Exact Mass | 398.03 |
| IUPAC Name | 1-(3-pyridin-1-ium-1-ylpropyl)pyridin-1-ium diperchlorate |
| SMILES | [O-][Cl+3]([O-])([O-])[O-].[O-][Cl+3]([O-])([O-])[O-].c1cc[n+](CCC[n+]2ccccc2)cc1 |
| InChI | InChI=1S/C13H16N2.2ClHO4/c1-3-8-14(9-4-1)12-7-13-15-10-5-2-6-11-15;2*2-1(3,4)5/h1-6,8-11H,7,12-13H2;2*(H,2,3,4,5)/q+2;;/p-2 |
| InChIKey | OXWDSQORNYQOFZ-UHFFFAOYSA-L |
| XLogP | -8.16 |
| TPSA | 192.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.18 |
| LogP ≤ 5 | -8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|