About benzene;copper;trifluoromethanesulfonic acid
benzene;copper;trifluoromethanesulfonic acid (PubChem CID 87130846) has the molecular formula C7H7CuF3O3S
and a molecular weight of 291.74 g/mol. Its IUPAC name is benzene;copper;trifluoromethanesulfonic acid.
Molecular Properties
| Compound Name | benzene;copper;trifluoromethanesulfonic acid |
| PubChem CID | 87130846 |
| Molecular Formula | C7H7CuF3O3S |
| Molecular Weight | 291.74 g/mol |
| Exact Mass | 290.94 |
| IUPAC Name | benzene;copper;trifluoromethanesulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)F.[Cu].c1ccccc1 |
| InChI | InChI=1S/C6H6.CHF3O3S.Cu/c1-2-4-6-5-3-1;2-1(3,4)8(5,6)7;/h1-6H;(H,5,6,7); |
| InChIKey | RQVNQRDXZGFILT-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.74 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze benzene;copper;trifluoromethanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;copper;trifluoromethanesulfonic acid?
The IUPAC name of benzene;copper;trifluoromethanesulfonic acid (CID 87130846) is benzene;copper;trifluoromethanesulfonic acid.
What is the SMILES notation for benzene;copper;trifluoromethanesulfonic acid?
The canonical SMILES for benzene;copper;trifluoromethanesulfonic acid is O=S(=O)(O)C(F)(F)F.[Cu].c1ccccc1.
What is the InChIKey of benzene;copper;trifluoromethanesulfonic acid?
The InChIKey is RQVNQRDXZGFILT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6.CHF3O3S.Cu/c1-2-4-6-5-3-1;2-1(3,4)8(5,6)7;/h1-6H;(H,5,6,7);.
What are the key properties of benzene;copper;trifluoromethanesulfonic acid?
benzene;copper;trifluoromethanesulfonic acid has a molecular weight of 291.74 g/mol, XLogP of 2.08, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;copper;trifluoromethanesulfonic acid is sourced from PubChem (CID 87130846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).