About bis(trifluoromethanesulfonic acid);ytterbium
bis(trifluoromethanesulfonic acid);ytterbium (PubChem CID 72641674) has the molecular formula C2H2F6O6S2Yb
and a molecular weight of 473.19 g/mol. Its IUPAC name is bis(trifluoromethanesulfonic acid);ytterbium.
Molecular Properties
| Compound Name | bis(trifluoromethanesulfonic acid);ytterbium |
| PubChem CID | 72641674 |
| Molecular Formula | C2H2F6O6S2Yb |
| Molecular Weight | 473.19 g/mol |
| Exact Mass | 473.86 |
| IUPAC Name | bis(trifluoromethanesulfonic acid);ytterbium |
| SMILES | O=S(=O)(O)C(F)(F)F.O=S(=O)(O)C(F)(F)F.[Yb] |
| InChI | InChI=1S/2CHF3O3S.Yb/c2*2-1(3,4)8(5,6)7;/h2*(H,5,6,7); |
| InChIKey | MPVSGDNEKUCYMK-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 473.19 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze bis(trifluoromethanesulfonic acid);ytterbium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(trifluoromethanesulfonic acid);ytterbium?
The IUPAC name of bis(trifluoromethanesulfonic acid);ytterbium (CID 72641674) is bis(trifluoromethanesulfonic acid);ytterbium.
What is the SMILES notation for bis(trifluoromethanesulfonic acid);ytterbium?
The canonical SMILES for bis(trifluoromethanesulfonic acid);ytterbium is O=S(=O)(O)C(F)(F)F.O=S(=O)(O)C(F)(F)F.[Yb].
What is the InChIKey of bis(trifluoromethanesulfonic acid);ytterbium?
The InChIKey is MPVSGDNEKUCYMK-UHFFFAOYSA-N. The full InChI is InChI=1S/2CHF3O3S.Yb/c2*2-1(3,4)8(5,6)7;/h2*(H,5,6,7);.
What are the key properties of bis(trifluoromethanesulfonic acid);ytterbium?
bis(trifluoromethanesulfonic acid);ytterbium has a molecular weight of 473.19 g/mol, XLogP of 0.79, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(trifluoromethanesulfonic acid);ytterbium is sourced from PubChem (CID 72641674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).