About osmium;bis(trifluoromethanesulfonic acid)
osmium;bis(trifluoromethanesulfonic acid) (PubChem CID 174919112) has the molecular formula C2H2F6O6OsS2
and a molecular weight of 490.38 g/mol. Its IUPAC name is osmium;bis(trifluoromethanesulfonic acid).
Molecular Properties
| Compound Name | osmium;bis(trifluoromethanesulfonic acid) |
| PubChem CID | 174919112 |
| Molecular Formula | C2H2F6O6OsS2 |
| Molecular Weight | 490.38 g/mol |
| Exact Mass | 491.88 |
| IUPAC Name | osmium;bis(trifluoromethanesulfonic acid) |
| SMILES | O=S(=O)(O)C(F)(F)F.O=S(=O)(O)C(F)(F)F.[Os] |
| InChI | InChI=1S/2CHF3O3S.Os/c2*2-1(3,4)8(5,6)7;/h2*(H,5,6,7); |
| InChIKey | URJOHXUNCWSQST-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 490.38 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze osmium;bis(trifluoromethanesulfonic acid) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of osmium;bis(trifluoromethanesulfonic acid)?
The IUPAC name of osmium;bis(trifluoromethanesulfonic acid) (CID 174919112) is osmium;bis(trifluoromethanesulfonic acid).
What is the SMILES notation for osmium;bis(trifluoromethanesulfonic acid)?
The canonical SMILES for osmium;bis(trifluoromethanesulfonic acid) is O=S(=O)(O)C(F)(F)F.O=S(=O)(O)C(F)(F)F.[Os].
What is the InChIKey of osmium;bis(trifluoromethanesulfonic acid)?
The InChIKey is URJOHXUNCWSQST-UHFFFAOYSA-N. The full InChI is InChI=1S/2CHF3O3S.Os/c2*2-1(3,4)8(5,6)7;/h2*(H,5,6,7);.
What are the key properties of osmium;bis(trifluoromethanesulfonic acid)?
osmium;bis(trifluoromethanesulfonic acid) has a molecular weight of 490.38 g/mol, XLogP of 0.79, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for osmium;bis(trifluoromethanesulfonic acid) is sourced from PubChem (CID 174919112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).