About hafnium;trifluoromethanesulfonic acid;hydrate
hafnium;trifluoromethanesulfonic acid;hydrate (PubChem CID 174756468) has the molecular formula CH3F3HfO4S
and a molecular weight of 346.58 g/mol. Its IUPAC name is hafnium;trifluoromethanesulfonic acid;hydrate.
Molecular Properties
| Compound Name | hafnium;trifluoromethanesulfonic acid;hydrate |
| PubChem CID | 174756468 |
| Molecular Formula | CH3F3HfO4S |
| Molecular Weight | 346.58 g/mol |
| Exact Mass | 347.92 |
| IUPAC Name | hafnium;trifluoromethanesulfonic acid;hydrate |
| SMILES | O.O=S(=O)(O)C(F)(F)F.[Hf] |
| InChI | InChI=1S/CHF3O3S.Hf.H2O/c2-1(3,4)8(5,6)7;;/h(H,5,6,7);;1H2 |
| InChIKey | OBDKLYKNDCESPS-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 85.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.58 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze hafnium;trifluoromethanesulfonic acid;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hafnium;trifluoromethanesulfonic acid;hydrate?
The IUPAC name of hafnium;trifluoromethanesulfonic acid;hydrate (CID 174756468) is hafnium;trifluoromethanesulfonic acid;hydrate.
What is the SMILES notation for hafnium;trifluoromethanesulfonic acid;hydrate?
The canonical SMILES for hafnium;trifluoromethanesulfonic acid;hydrate is O.O=S(=O)(O)C(F)(F)F.[Hf].
What is the InChIKey of hafnium;trifluoromethanesulfonic acid;hydrate?
The InChIKey is OBDKLYKNDCESPS-UHFFFAOYSA-N. The full InChI is InChI=1S/CHF3O3S.Hf.H2O/c2-1(3,4)8(5,6)7;;/h(H,5,6,7);;1H2.
What are the key properties of hafnium;trifluoromethanesulfonic acid;hydrate?
hafnium;trifluoromethanesulfonic acid;hydrate has a molecular weight of 346.58 g/mol, XLogP of -0.43, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hafnium;trifluoromethanesulfonic acid;hydrate is sourced from PubChem (CID 174756468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).