About boric acid;trifluoromethanesulfonic acid
boric acid;trifluoromethanesulfonic acid (PubChem CID 161076085) has the molecular formula CH4BF3O6S
and a molecular weight of 211.91 g/mol. Its IUPAC name is boric acid;trifluoromethanesulfonic acid.
Molecular Properties
| Compound Name | boric acid;trifluoromethanesulfonic acid |
| PubChem CID | 161076085 |
| Molecular Formula | CH4BF3O6S |
| Molecular Weight | 211.91 g/mol |
| Exact Mass | 211.98 |
| IUPAC Name | boric acid;trifluoromethanesulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)F.OB(O)O |
| InChI | InChI=1S/CHF3O3S.BH3O3/c2-1(3,4)8(5,6)7;2-1(3)4/h(H,5,6,7);2-4H |
| InChIKey | UFHHKLPNSSBHPW-UHFFFAOYSA-N |
| XLogP | -1.66 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.91 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze boric acid;trifluoromethanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of boric acid;trifluoromethanesulfonic acid?
The IUPAC name of boric acid;trifluoromethanesulfonic acid (CID 161076085) is boric acid;trifluoromethanesulfonic acid.
What is the SMILES notation for boric acid;trifluoromethanesulfonic acid?
The canonical SMILES for boric acid;trifluoromethanesulfonic acid is O=S(=O)(O)C(F)(F)F.OB(O)O.
What is the InChIKey of boric acid;trifluoromethanesulfonic acid?
The InChIKey is UFHHKLPNSSBHPW-UHFFFAOYSA-N. The full InChI is InChI=1S/CHF3O3S.BH3O3/c2-1(3,4)8(5,6)7;2-1(3)4/h(H,5,6,7);2-4H.
What are the key properties of boric acid;trifluoromethanesulfonic acid?
boric acid;trifluoromethanesulfonic acid has a molecular weight of 211.91 g/mol, XLogP of -1.66, 0 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for boric acid;trifluoromethanesulfonic acid is sourced from PubChem (CID 161076085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).