C15H19F3O3S — CID 160685071
benzene;cycloocta-1,5-diene;trifluoromethanesulfonic acid (PubChem CID 160685071) has the molecular formula C15H19F3O3S and a molecular weight of 336.38 g/mol. Its IUPAC name is benzene;cycloocta-1,5-diene;trifluoromethanesulfonic acid.
| Compound Name | benzene;cycloocta-1,5-diene;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 160685071 |
| Molecular Formula | C15H19F3O3S |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | benzene;cycloocta-1,5-diene;trifluoromethanesulfonic acid |
| SMILES | C1=CCCC=CCC1.O=S(=O)(O)C(F)(F)F.c1ccccc1 |
| InChI | InChI=1S/C8H12.C6H6.CHF3O3S/c1-2-4-6-8-7-5-3-1;1-2-4-6-5-3-1;2-1(3,4)8(5,6)7/h1-2,7-8H,3-6H2;1-6H;(H,5,6,7) |
| InChIKey | ROQQPGOVJJHHJO-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|