C13H5F16IO3S — CID 11735040
[phenyl(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-λ3-iodanyl] trifluoromethanesulfonate (PubChem CID 11735040) has the molecular formula C13H5F16IO3S and a molecular weight of 672.12 g/mol. Its IUPAC name is [phenyl(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-λ3-iodanyl] trifluoromethanesulfonate.
| Compound Name | [phenyl(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-λ3-iodanyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11735040 |
| Molecular Formula | C13H5F16IO3S |
| Molecular Weight | 672.12 g/mol |
| Exact Mass | 671.87 |
| IUPAC Name | [phenyl(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-λ3-iodanyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(OI(c1ccccc1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H5F16IO3S/c14-7(15,9(18,19)11(22,23)24)8(16,17)10(20,21)12(25,26)30(6-4-2-1-3-5-6)33-34(31,32)13(27,28)29/h1-5H |
| InChIKey | VJWKRFMZWLILID-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.12 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|