C9H5F7I+ — CID 2760328
1,1,2,2,3,3,3-heptafluoropropyl(phenyl)iodanium (PubChem CID 2760328) has the molecular formula C9H5F7I+ and a molecular weight of 373.03 g/mol. Its IUPAC name is 1,1,2,2,3,3,3-heptafluoropropyl(phenyl)iodanium.
| Compound Name | 1,1,2,2,3,3,3-heptafluoropropyl(phenyl)iodanium |
|---|---|
| PubChem CID | 2760328 |
| Molecular Formula | C9H5F7I+ |
| Molecular Weight | 373.03 g/mol |
| Exact Mass | 372.93 |
| IUPAC Name | 1,1,2,2,3,3,3-heptafluoropropyl(phenyl)iodanium |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)[I+]c1ccccc1 |
| InChI | InChI=1S/C9H5F7I/c10-7(11,8(12,13)14)9(15,16)17-6-4-2-1-3-5-6/h1-5H/q+1 |
| InChIKey | RKQPNRUABHNCIX-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.03 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|