C17H21N4O5S+ — CID 91255414
4-[3-[[methyl-(4-nitrophenyl)hydrazinylidene]methyl]pyridin-1-ium-1-yl]butane-1-sulfonic acid (PubChem CID 91255414) has the molecular formula C17H21N4O5S+ and a molecular weight of 393.45 g/mol. Its IUPAC name is 4-[3-[[methyl-(4-nitrophenyl)hydrazinylidene]methyl]pyridin-1-ium-1-yl]butane-1-sulfonic acid.
| Compound Name | 4-[3-[[methyl-(4-nitrophenyl)hydrazinylidene]methyl]pyridin-1-ium-1-yl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 91255414 |
| Molecular Formula | C17H21N4O5S+ |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 4-[3-[[methyl-(4-nitrophenyl)hydrazinylidene]methyl]pyridin-1-ium-1-yl]butane-1-sulfonic acid |
| SMILES | CN(N=Cc1ccc[n+](CCCCS(=O)(=O)O)c1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H20N4O5S/c1-19(16-6-8-17(9-7-16)21(22)23)18-13-15-5-4-11-20(14-15)10-2-3-12-27(24,25)26/h4-9,11,13-14H,2-3,10,12H2,1H3/p+1 |
| InChIKey | QKAYHCBDEWWHDE-UHFFFAOYSA-O |
| XLogP | 2.02 |
| TPSA | 116.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|