C33H40N6O2+2 — CID 58637419
4-methoxy-N-[(E)-[1-[5-[4-[(E)-[(4-methoxyphenyl)-methylhydrazinylidene]methyl]pyridin-1-ium-1-yl]pentyl]pyridin-1-ium-4-yl]methylideneamino]-N-methylaniline (PubChem CID 58637419) has the molecular formula C33H40N6O2+2 and a molecular weight of 552.72 g/mol. Its IUPAC name is 4-methoxy-N-[(E)-[1-[5-[4-[(E)-[(4-methoxyphenyl)-methylhydrazinylidene]methyl]pyridin-1-ium-1-yl]pentyl]pyridin-1-ium-4-yl]methylideneamino]-N-methylaniline.
| Compound Name | 4-methoxy-N-[(E)-[1-[5-[4-[(E)-[(4-methoxyphenyl)-methylhydrazinylidene]methyl]pyridin-1-ium-1-yl]pentyl]pyridin-1-ium-4-yl]methylideneamino]-N-methylaniline |
|---|---|
| PubChem CID | 58637419 |
| Molecular Formula | C33H40N6O2+2 |
| Molecular Weight | 552.72 g/mol |
| Exact Mass | 552.32 |
| IUPAC Name | 4-methoxy-N-[(E)-[1-[5-[4-[(E)-[(4-methoxyphenyl)-methylhydrazinylidene]methyl]pyridin-1-ium-1-yl]pentyl]pyridin-1-ium-4-yl]methylideneamino]-N-methylaniline |
| SMILES | COc1ccc(N(C)/N=C/c2cc[n+](CCCCC[n+]3ccc(/C=N/N(C)c4ccc(OC)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C33H40N6O2/c1-36(30-8-12-32(40-3)13-9-30)34-26-28-16-22-38(23-17-28)20-6-5-7-21-39-24-18-29(19-25-39)27-35-37(2)31-10-14-33(41-4)15-11-31/h8-19,22-27H,5-7,20-21H2,1-4H3/q+2 |
| InChIKey | LCPUAKPILAUAMB-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 57.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.72 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|