C18H24N3+ — CID 143565582
N-methyl-N-[(E)-(1-pentylpyridin-1-ium-4-yl)methylideneamino]aniline (PubChem CID 143565582) has the molecular formula C18H24N3+ and a molecular weight of 282.41 g/mol. Its IUPAC name is N-methyl-N-[(E)-(1-pentylpyridin-1-ium-4-yl)methylideneamino]aniline.
| Compound Name | N-methyl-N-[(E)-(1-pentylpyridin-1-ium-4-yl)methylideneamino]aniline |
|---|---|
| PubChem CID | 143565582 |
| Molecular Formula | C18H24N3+ |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.20 |
| IUPAC Name | N-methyl-N-[(E)-(1-pentylpyridin-1-ium-4-yl)methylideneamino]aniline |
| SMILES | CCCCC[n+]1ccc(/C=N/N(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H24N3/c1-3-4-8-13-21-14-11-17(12-15-21)16-19-20(2)18-9-6-5-7-10-18/h5-7,9-12,14-16H,3-4,8,13H2,1-2H3/q+1 |
| InChIKey | LEXLDQLZWXUQHI-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 19.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|