C32H39Cl2N7 — CID 172953453
N,N-dimethyl-4-[[1-[6-[4-[(Z)-[methyl(phenyl)hydrazinylidene]methyl]pyridin-1-ium-1-yl]hexyl]pyridin-1-ium-2-yl]diazenyl]aniline dichloride (PubChem CID 172953453) has the molecular formula C32H39Cl2N7 and a molecular weight of 592.62 g/mol. Its IUPAC name is N,N-dimethyl-4-[[1-[6-[4-[(Z)-[methyl(phenyl)hydrazinylidene]methyl]pyridin-1-ium-1-yl]hexyl]pyridin-1-ium-2-yl]diazenyl]aniline dichloride.
| Compound Name | N,N-dimethyl-4-[[1-[6-[4-[(Z)-[methyl(phenyl)hydrazinylidene]methyl]pyridin-1-ium-1-yl]hexyl]pyridin-1-ium-2-yl]diazenyl]aniline dichloride |
|---|---|
| PubChem CID | 172953453 |
| Molecular Formula | C32H39Cl2N7 |
| Molecular Weight | 592.62 g/mol |
| Exact Mass | 591.26 |
| IUPAC Name | N,N-dimethyl-4-[[1-[6-[4-[(Z)-[methyl(phenyl)hydrazinylidene]methyl]pyridin-1-ium-1-yl]hexyl]pyridin-1-ium-2-yl]diazenyl]aniline dichloride |
| SMILES | CN(C)c1ccc(/N=N/c2cccc[n+]2CCCCCC[n+]2ccc(/C=N\N(C)c3ccccc3)cc2)cc1.[Cl-].[Cl-] |
| InChI | InChI=1S/C32H39N7.2ClH/c1-36(2)30-18-16-29(17-19-30)34-35-32-15-9-12-24-39(32)23-11-5-4-10-22-38-25-20-28(21-26-38)27-33-37(3)31-13-7-6-8-14-31;;/h6-9,12-21,24-27H,4-5,10-11,22-23H2,1-3H3;2*1H/q+2;;/p-2 |
| InChIKey | ILLAHZCSJIAYRF-UHFFFAOYSA-L |
| XLogP | 0.48 |
| TPSA | 51.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.62 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|