C29H33Br2N7 — CID 172919753
N,N-dimethyl-4-[[1-[3-[4-[(Z)-[methyl(phenyl)hydrazinylidene]methyl]pyridin-1-ium-1-yl]propyl]pyridin-1-ium-4-yl]diazenyl]aniline dibromide (PubChem CID 172919753) has the molecular formula C29H33Br2N7 and a molecular weight of 639.44 g/mol. Its IUPAC name is N,N-dimethyl-4-[[1-[3-[4-[(Z)-[methyl(phenyl)hydrazinylidene]methyl]pyridin-1-ium-1-yl]propyl]pyridin-1-ium-4-yl]diazenyl]aniline dibromide.
| Compound Name | N,N-dimethyl-4-[[1-[3-[4-[(Z)-[methyl(phenyl)hydrazinylidene]methyl]pyridin-1-ium-1-yl]propyl]pyridin-1-ium-4-yl]diazenyl]aniline dibromide |
|---|---|
| PubChem CID | 172919753 |
| Molecular Formula | C29H33Br2N7 |
| Molecular Weight | 639.44 g/mol |
| Exact Mass | 637.12 |
| IUPAC Name | N,N-dimethyl-4-[[1-[3-[4-[(Z)-[methyl(phenyl)hydrazinylidene]methyl]pyridin-1-ium-1-yl]propyl]pyridin-1-ium-4-yl]diazenyl]aniline dibromide |
| SMILES | CN(C)c1ccc(/N=N/c2cc[n+](CCC[n+]3ccc(/C=N\N(C)c4ccccc4)cc3)cc2)cc1.[Br-].[Br-] |
| InChI | InChI=1S/C29H33N7.2BrH/c1-33(2)28-12-10-26(11-13-28)31-32-27-16-22-36(23-17-27)19-7-18-35-20-14-25(15-21-35)24-30-34(3)29-8-5-4-6-9-29;;/h4-6,8-17,20-24H,7,18-19H2,1-3H3;2*1H/q+2;;/p-2 |
| InChIKey | BHMZKFXLTLMIIP-UHFFFAOYSA-L |
| XLogP | -0.69 |
| TPSA | 51.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.44 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|