C15H19N4+ — CID 76745592
N-[[1-(2-aminoethyl)pyridin-1-ium-4-yl]methylideneamino]-N-methylaniline (PubChem CID 76745592) has the molecular formula C15H19N4+ and a molecular weight of 255.35 g/mol. Its IUPAC name is N-[[1-(2-aminoethyl)pyridin-1-ium-4-yl]methylideneamino]-N-methylaniline.
| Compound Name | N-[[1-(2-aminoethyl)pyridin-1-ium-4-yl]methylideneamino]-N-methylaniline |
|---|---|
| PubChem CID | 76745592 |
| Molecular Formula | C15H19N4+ |
| Molecular Weight | 255.35 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | N-[[1-(2-aminoethyl)pyridin-1-ium-4-yl]methylideneamino]-N-methylaniline |
| SMILES | CN(N=Cc1cc[n+](CCN)cc1)c1ccccc1 |
| InChI | InChI=1S/C15H19N4/c1-18(15-5-3-2-4-6-15)17-13-14-7-10-19(11-8-14)12-9-16/h2-8,10-11,13H,9,12,16H2,1H3/q+1 |
| InChIKey | PJMSFDPFEHDTBN-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 45.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.35 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|