C34H38Cl2N6O2S2 — CID 158063089
1-S-[2-[4-[(E)-[methyl(phenyl)hydrazinylidene]methyl]pyridin-1-ium-1-yl]ethyl] 4-S-[2-[4-[(Z)-[methyl(phenyl)hydrazinylidene]methyl]pyridin-1-ium-1-yl]ethyl] butanebis(thioate) dichloride (PubChem CID 158063089) has the molecular formula C34H38Cl2N6O2S2 and a molecular weight of 697.76 g/mol. Its IUPAC name is 1-S-[2-[4-[(E)-[methyl(phenyl)hydrazinylidene]methyl]pyridin-1-ium-1-yl]ethyl] 4-S-[2-[4-[(Z)-[methyl(phenyl)hydrazinylidene]methyl]pyridin-1-ium-1-yl]ethyl] butanebis(thioate) dichloride.
| Compound Name | 1-S-[2-[4-[(E)-[methyl(phenyl)hydrazinylidene]methyl]pyridin-1-ium-1-yl]ethyl] 4-S-[2-[4-[(Z)-[methyl(phenyl)hydrazinylidene]methyl]pyridin-1-ium-1-yl]ethyl] butanebis(thioate) dichloride |
|---|---|
| PubChem CID | 158063089 |
| Molecular Formula | C34H38Cl2N6O2S2 |
| Molecular Weight | 697.76 g/mol |
| Exact Mass | 696.19 |
| IUPAC Name | 1-S-[2-[4-[(E)-[methyl(phenyl)hydrazinylidene]methyl]pyridin-1-ium-1-yl]ethyl] 4-S-[2-[4-[(Z)-[methyl(phenyl)hydrazinylidene]methyl]pyridin-1-ium-1-yl]ethyl] butanebis(thioate) dichloride |
| SMILES | CN(/N=C\c1cc[n+](CCSC(=O)CCC(=O)SCC[n+]2ccc(/C=N/N(C)c3ccccc3)cc2)cc1)c1ccccc1.[Cl-].[Cl-] |
| InChI | InChI=1S/C34H38N6O2S2.2ClH/c1-37(31-9-5-3-6-10-31)35-27-29-15-19-39(20-16-29)23-25-43-33(41)13-14-34(42)44-26-24-40-21-17-30(18-22-40)28-36-38(2)32-11-7-4-8-12-32;;/h3-12,15-22,27-28H,13-14,23-26H2,1-2H3;2*1H/q+2;;/p-2 |
| InChIKey | JPKCYHIOYHZOEB-UHFFFAOYSA-L |
| XLogP | -0.79 |
| TPSA | 73.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.76 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|