C39H41BrClN7O — CID 172963123
N-[8-(diethylamino)-10-phenylphenazin-10-ium-2-yl]-4-[4-[(E)-[methyl(phenyl)hydrazinylidene]methyl]pyridin-1-ium-1-yl]butanamide;bromide;chloride (PubChem CID 172963123) has the molecular formula C39H41BrClN7O and a molecular weight of 739.16 g/mol. Its IUPAC name is N-[8-(diethylamino)-10-phenylphenazin-10-ium-2-yl]-4-[4-[(E)-[methyl(phenyl)hydrazinylidene]methyl]pyridin-1-ium-1-yl]butanamide;bromide;chloride.
| Compound Name | N-[8-(diethylamino)-10-phenylphenazin-10-ium-2-yl]-4-[4-[(E)-[methyl(phenyl)hydrazinylidene]methyl]pyridin-1-ium-1-yl]butanamide;bromide;chloride |
|---|---|
| PubChem CID | 172963123 |
| Molecular Formula | C39H41BrClN7O |
| Molecular Weight | 739.16 g/mol |
| Exact Mass | 737.22 |
| IUPAC Name | N-[8-(diethylamino)-10-phenylphenazin-10-ium-2-yl]-4-[4-[(E)-[methyl(phenyl)hydrazinylidene]methyl]pyridin-1-ium-1-yl]butanamide;bromide;chloride |
| SMILES | CCN(CC)c1ccc2nc3ccc(NC(=O)CCC[n+]4ccc(/C=N/N(C)c5ccccc5)cc4)cc3[n+](-c3ccccc3)c2c1.[Br-].[Cl-] |
| InChI | InChI=1S/C39H40N7O.BrH.ClH/c1-4-45(5-2)34-19-21-36-38(28-34)46(33-15-10-7-11-16-33)37-27-31(18-20-35(37)42-36)41-39(47)17-12-24-44-25-22-30(23-26-44)29-40-43(3)32-13-8-6-9-14-32;;/h6-11,13-16,18-23,25-29H,4-5,12,17,24H2,1-3H3;2*1H/q+1;;/p-1 |
| InChIKey | VHIHSRBAWFKMFG-UHFFFAOYSA-M |
| XLogP | 0.70 |
| TPSA | 68.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.16 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|