C34H41Br2N7O2 — CID 172986944
methyl 5-(dimethylamino)-2-[[1-[6-[4-[(Z)-[methyl(phenyl)hydrazinylidene]methyl]pyridin-1-ium-1-yl]hexyl]pyridin-1-ium-4-yl]diazenyl]benzoate dibromide (PubChem CID 172986944) has the molecular formula C34H41Br2N7O2 and a molecular weight of 739.56 g/mol. Its IUPAC name is methyl 5-(dimethylamino)-2-[[1-[6-[4-[(Z)-[methyl(phenyl)hydrazinylidene]methyl]pyridin-1-ium-1-yl]hexyl]pyridin-1-ium-4-yl]diazenyl]benzoate dibromide.
| Compound Name | methyl 5-(dimethylamino)-2-[[1-[6-[4-[(Z)-[methyl(phenyl)hydrazinylidene]methyl]pyridin-1-ium-1-yl]hexyl]pyridin-1-ium-4-yl]diazenyl]benzoate dibromide |
|---|---|
| PubChem CID | 172986944 |
| Molecular Formula | C34H41Br2N7O2 |
| Molecular Weight | 739.56 g/mol |
| Exact Mass | 737.17 |
| IUPAC Name | methyl 5-(dimethylamino)-2-[[1-[6-[4-[(Z)-[methyl(phenyl)hydrazinylidene]methyl]pyridin-1-ium-1-yl]hexyl]pyridin-1-ium-4-yl]diazenyl]benzoate dibromide |
| SMILES | COC(=O)c1cc(N(C)C)ccc1/N=N/c1cc[n+](CCCCCC[n+]2ccc(/C=N\N(C)c3ccccc3)cc2)cc1.[Br-].[Br-] |
| InChI | InChI=1S/C34H41N7O2.2BrH/c1-38(2)31-14-15-33(32(26-31)34(42)43-4)37-36-29-18-24-41(25-19-29)21-11-6-5-10-20-40-22-16-28(17-23-40)27-35-39(3)30-12-8-7-9-13-30;;/h7-9,12-19,22-27H,5-6,10-11,20-21H2,1-4H3;2*1H/q+2;;/p-2 |
| InChIKey | FYOFRZMRRJRSKQ-UHFFFAOYSA-L |
| XLogP | 0.27 |
| TPSA | 77.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.56 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|