C32H38N6+2 — CID 23117094
N-methyl-N-[(E)-[1-[6-[4-[(E)-[methyl(phenyl)hydrazinylidene]methyl]pyridin-1-ium-1-yl]hexyl]pyridin-1-ium-4-yl]methylideneamino]aniline (PubChem CID 23117094) has the molecular formula C32H38N6+2 and a molecular weight of 506.70 g/mol. Its IUPAC name is N-methyl-N-[(E)-[1-[6-[4-[(E)-[methyl(phenyl)hydrazinylidene]methyl]pyridin-1-ium-1-yl]hexyl]pyridin-1-ium-4-yl]methylideneamino]aniline.
| Compound Name | N-methyl-N-[(E)-[1-[6-[4-[(E)-[methyl(phenyl)hydrazinylidene]methyl]pyridin-1-ium-1-yl]hexyl]pyridin-1-ium-4-yl]methylideneamino]aniline |
|---|---|
| PubChem CID | 23117094 |
| Molecular Formula | C32H38N6+2 |
| Molecular Weight | 506.70 g/mol |
| Exact Mass | 506.31 |
| IUPAC Name | N-methyl-N-[(E)-[1-[6-[4-[(E)-[methyl(phenyl)hydrazinylidene]methyl]pyridin-1-ium-1-yl]hexyl]pyridin-1-ium-4-yl]methylideneamino]aniline |
| SMILES | CN(/N=C/c1cc[n+](CCCCCC[n+]2ccc(/C=N/N(C)c3ccccc3)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C32H38N6/c1-35(31-13-7-5-8-14-31)33-27-29-17-23-37(24-18-29)21-11-3-4-12-22-38-25-19-30(20-26-38)28-34-36(2)32-15-9-6-10-16-32/h5-10,13-20,23-28H,3-4,11-12,21-22H2,1-2H3/q+2 |
| InChIKey | KAKBCFJNKDCBHX-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 38.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.70 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|