C30H35N6S2+ — CID 143373711
N-methyl-N-[(E)-[1-[2-[2-[[(2E)-3-[(E)-[methyl(phenyl)hydrazinylidene]methyl]penta-2,4-dienylidene]amino]ethyldisulfanyl]ethyl]pyridin-1-ium-4-yl]methylideneamino]aniline (PubChem CID 143373711) has the molecular formula C30H35N6S2+ and a molecular weight of 543.79 g/mol. Its IUPAC name is N-methyl-N-[(E)-[1-[2-[2-[[(2E)-3-[(E)-[methyl(phenyl)hydrazinylidene]methyl]penta-2,4-dienylidene]amino]ethyldisulfanyl]ethyl]pyridin-1-ium-4-yl]methylideneamino]aniline.
| Compound Name | N-methyl-N-[(E)-[1-[2-[2-[[(2E)-3-[(E)-[methyl(phenyl)hydrazinylidene]methyl]penta-2,4-dienylidene]amino]ethyldisulfanyl]ethyl]pyridin-1-ium-4-yl]methylideneamino]aniline |
|---|---|
| PubChem CID | 143373711 |
| Molecular Formula | C30H35N6S2+ |
| Molecular Weight | 543.79 g/mol |
| Exact Mass | 543.24 |
| IUPAC Name | N-methyl-N-[(E)-[1-[2-[2-[[(2E)-3-[(E)-[methyl(phenyl)hydrazinylidene]methyl]penta-2,4-dienylidene]amino]ethyldisulfanyl]ethyl]pyridin-1-ium-4-yl]methylideneamino]aniline |
| SMILES | C=CC(/C=N/N(C)c1ccccc1)=C\C=N\CCSSCC[n+]1ccc(/C=N/N(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H35N6S2/c1-4-27(25-32-34(2)29-11-7-5-8-12-29)15-18-31-19-23-37-38-24-22-36-20-16-28(17-21-36)26-33-35(3)30-13-9-6-10-14-30/h4-18,20-21,25-26H,1,19,22-24H2,2-3H3/q+1/b27-15+,31-18+,32-25+ |
| InChIKey | VREJDWRJGBPZGQ-UCNRCXLLSA-N |
| XLogP | 6.13 |
| TPSA | 47.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.79 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|