C36H45N4O2S2+ — CID 123261757
4-[2-[1-[2-[2-[[5-[4-(dimethylamino)-2-methoxyphenyl]-3-ethenylpenta-2,4-dienylidene]amino]ethyldisulfanyl]ethyl]pyridin-1-ium-4-yl]ethenyl]-3-methoxy-N,N-dimethylaniline (PubChem CID 123261757) has the molecular formula C36H45N4O2S2+ and a molecular weight of 629.92 g/mol. Its IUPAC name is 4-[2-[1-[2-[2-[[5-[4-(dimethylamino)-2-methoxyphenyl]-3-ethenylpenta-2,4-dienylidene]amino]ethyldisulfanyl]ethyl]pyridin-1-ium-4-yl]ethenyl]-3-methoxy-N,N-dimethylaniline.
| Compound Name | 4-[2-[1-[2-[2-[[5-[4-(dimethylamino)-2-methoxyphenyl]-3-ethenylpenta-2,4-dienylidene]amino]ethyldisulfanyl]ethyl]pyridin-1-ium-4-yl]ethenyl]-3-methoxy-N,N-dimethylaniline |
|---|---|
| PubChem CID | 123261757 |
| Molecular Formula | C36H45N4O2S2+ |
| Molecular Weight | 629.92 g/mol |
| Exact Mass | 629.30 |
| IUPAC Name | 4-[2-[1-[2-[2-[[5-[4-(dimethylamino)-2-methoxyphenyl]-3-ethenylpenta-2,4-dienylidene]amino]ethyldisulfanyl]ethyl]pyridin-1-ium-4-yl]ethenyl]-3-methoxy-N,N-dimethylaniline |
| SMILES | C=CC(C=Cc1ccc(N(C)C)cc1OC)=C/C=N/CCSSCC[n+]1ccc(C=Cc2ccc(N(C)C)cc2OC)cc1 |
| InChI | InChI=1S/C36H45N4O2S2/c1-8-29(9-11-31-13-15-33(38(2)3)27-35(31)41-6)17-20-37-21-25-43-44-26-24-40-22-18-30(19-23-40)10-12-32-14-16-34(39(4)5)28-36(32)42-7/h8-20,22-23,27-28H,1,21,24-26H2,2-7H3/q+1/b11-9?,29-17?,37-20+ |
| InChIKey | ZEOVIZHVMVPZLV-WFYSVVJQSA-N |
| XLogP | 7.57 |
| TPSA | 41.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.92 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|