C20H21N4+ — CID 76699706
4-N-methyl-4-N-[(1-methylpyridin-1-ium-4-yl)methylideneamino]-1-N-phenylbenzene-1,4-diamine (PubChem CID 76699706) has the molecular formula C20H21N4+ and a molecular weight of 317.42 g/mol. Its IUPAC name is 4-N-methyl-4-N-[(1-methylpyridin-1-ium-4-yl)methylideneamino]-1-N-phenylbenzene-1,4-diamine.
| Compound Name | 4-N-methyl-4-N-[(1-methylpyridin-1-ium-4-yl)methylideneamino]-1-N-phenylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 76699706 |
| Molecular Formula | C20H21N4+ |
| Molecular Weight | 317.42 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | 4-N-methyl-4-N-[(1-methylpyridin-1-ium-4-yl)methylideneamino]-1-N-phenylbenzene-1,4-diamine |
| SMILES | CN(N=Cc1cc[n+](C)cc1)c1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C20H21N4/c1-23-14-12-17(13-15-23)16-21-24(2)20-10-8-19(9-11-20)22-18-6-4-3-5-7-18/h3-16,22H,1-2H3/q+1 |
| InChIKey | YRAYVJFGYNVBOY-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 31.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.42 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|