C20H22N5+ — CID 141093752
6-[methyl(phenyl)hydrazinylidene]-N-[(1-methylpyridin-1-ium-4-yl)methylideneamino]cyclohexa-2,4-dien-1-amine (PubChem CID 141093752) has the molecular formula C20H22N5+ and a molecular weight of 332.43 g/mol. Its IUPAC name is 6-[methyl(phenyl)hydrazinylidene]-N-[(1-methylpyridin-1-ium-4-yl)methylideneamino]cyclohexa-2,4-dien-1-amine.
| Compound Name | 6-[methyl(phenyl)hydrazinylidene]-N-[(1-methylpyridin-1-ium-4-yl)methylideneamino]cyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 141093752 |
| Molecular Formula | C20H22N5+ |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | 6-[methyl(phenyl)hydrazinylidene]-N-[(1-methylpyridin-1-ium-4-yl)methylideneamino]cyclohexa-2,4-dien-1-amine |
| SMILES | CN(N=C1C=CC=CC1NN=Cc1cc[n+](C)cc1)c1ccccc1 |
| InChI | InChI=1S/C20H21N5/c1-24-14-12-17(13-15-24)16-21-22-19-10-6-7-11-20(19)23-25(2)18-8-4-3-5-9-18/h3-16,19H,1-2H3/p+1 |
| InChIKey | ZJZZVQMEFHGHPP-UHFFFAOYSA-O |
| XLogP | 2.42 |
| TPSA | 43.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|