C21H30BrN4+ — CID 135312707
1-bromo-N'-[(E)-(1-hexylpyridin-1-ium-4-yl)methylideneamino]-N'-phenylpropane-1,3-diamine (PubChem CID 135312707) has the molecular formula C21H30BrN4+ and a molecular weight of 418.40 g/mol. Its IUPAC name is 1-bromo-N'-[(E)-(1-hexylpyridin-1-ium-4-yl)methylideneamino]-N'-phenylpropane-1,3-diamine.
| Compound Name | 1-bromo-N'-[(E)-(1-hexylpyridin-1-ium-4-yl)methylideneamino]-N'-phenylpropane-1,3-diamine |
|---|---|
| PubChem CID | 135312707 |
| Molecular Formula | C21H30BrN4+ |
| Molecular Weight | 418.40 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | 1-bromo-N'-[(E)-(1-hexylpyridin-1-ium-4-yl)methylideneamino]-N'-phenylpropane-1,3-diamine |
| SMILES | CCCCCC[n+]1ccc(/C=N/N(CCC(N)Br)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H30BrN4/c1-2-3-4-8-14-25-15-11-19(12-16-25)18-24-26(17-13-21(22)23)20-9-6-5-7-10-20/h5-7,9-12,15-16,18,21H,2-4,8,13-14,17,23H2,1H3/q+1 |
| InChIKey | RKPPUIKRTJOPFP-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 45.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.40 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|