C28H31BrN4O2 — CID 122538174
2-[3-(N-[(E)-(1-pentylpyridin-1-ium-4-yl)methylideneamino]anilino)propyl]isoindole-1,3-dione bromide (PubChem CID 122538174) has the molecular formula C28H31BrN4O2 and a molecular weight of 535.49 g/mol. Its IUPAC name is 2-[3-(N-[(E)-(1-pentylpyridin-1-ium-4-yl)methylideneamino]anilino)propyl]isoindole-1,3-dione bromide.
| Compound Name | 2-[3-(N-[(E)-(1-pentylpyridin-1-ium-4-yl)methylideneamino]anilino)propyl]isoindole-1,3-dione bromide |
|---|---|
| PubChem CID | 122538174 |
| Molecular Formula | C28H31BrN4O2 |
| Molecular Weight | 535.49 g/mol |
| Exact Mass | 534.16 |
| IUPAC Name | 2-[3-(N-[(E)-(1-pentylpyridin-1-ium-4-yl)methylideneamino]anilino)propyl]isoindole-1,3-dione bromide |
| SMILES | CCCCC[n+]1ccc(/C=N/N(CCCN2C(=O)c3ccccc3C2=O)c2ccccc2)cc1.[Br-] |
| InChI | InChI=1S/C28H31N4O2.BrH/c1-2-3-9-17-30-20-15-23(16-21-30)22-29-32(24-11-5-4-6-12-24)19-10-18-31-27(33)25-13-7-8-14-26(25)28(31)34;/h4-8,11-16,20-22H,2-3,9-10,17-19H2,1H3;1H/q+1;/p-1 |
| InChIKey | UORCAFPCEQMVNK-UHFFFAOYSA-M |
| XLogP | 1.70 |
| TPSA | 56.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.49 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|