C23H30N2 — CID 162802128
N-(benzylideneamino)-N-[(3S)-3,7-dimethyloct-7-enyl]aniline (PubChem CID 162802128) has the molecular formula C23H30N2 and a molecular weight of 334.51 g/mol. Its IUPAC name is N-(benzylideneamino)-N-[(3S)-3,7-dimethyloct-7-enyl]aniline.
| Compound Name | N-(benzylideneamino)-N-[(3S)-3,7-dimethyloct-7-enyl]aniline |
|---|---|
| PubChem CID | 162802128 |
| Molecular Formula | C23H30N2 |
| Molecular Weight | 334.51 g/mol |
| Exact Mass | 334.24 |
| IUPAC Name | N-(benzylideneamino)-N-[(3S)-3,7-dimethyloct-7-enyl]aniline |
| SMILES | C=C(C)CCC[C@H](C)CCN(N=Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H30N2/c1-20(2)11-10-12-21(3)17-18-25(23-15-8-5-9-16-23)24-19-22-13-6-4-7-14-22/h4-9,13-16,19,21H,1,10-12,17-18H2,2-3H3/t21-/m0/s1 |
| InChIKey | GJDPFZURUFCRKQ-NRFANRHFSA-N |
| XLogP | 6.30 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.51 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|