C21H20N2 — CID 6268194
N-benzyl-N-[(Z)-(4-methylphenyl)methylideneamino]aniline (PubChem CID 6268194) has the molecular formula C21H20N2 and a molecular weight of 300.41 g/mol. Its IUPAC name is N-benzyl-N-[(Z)-(4-methylphenyl)methylideneamino]aniline.
| Compound Name | N-benzyl-N-[(Z)-(4-methylphenyl)methylideneamino]aniline |
|---|---|
| PubChem CID | 6268194 |
| Molecular Formula | C21H20N2 |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | N-benzyl-N-[(Z)-(4-methylphenyl)methylideneamino]aniline |
| SMILES | Cc1ccc(/C=N\N(Cc2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H20N2/c1-18-12-14-19(15-13-18)16-22-23(21-10-6-3-7-11-21)17-20-8-4-2-5-9-20/h2-16H,17H2,1H3/b22-16- |
| InChIKey | AFUIHSULLXFUBB-JWGURIENSA-N |
| XLogP | 5.04 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|