C30H29N3O — CID 85434701
4-methyl-N-(4-methylphenyl)-N-[4-[[oxiran-2-ylmethyl(phenyl)hydrazinylidene]methyl]phenyl]aniline (PubChem CID 85434701) has the molecular formula C30H29N3O and a molecular weight of 447.58 g/mol. Its IUPAC name is 4-methyl-N-(4-methylphenyl)-N-[4-[[oxiran-2-ylmethyl(phenyl)hydrazinylidene]methyl]phenyl]aniline.
| Compound Name | 4-methyl-N-(4-methylphenyl)-N-[4-[[oxiran-2-ylmethyl(phenyl)hydrazinylidene]methyl]phenyl]aniline |
|---|---|
| PubChem CID | 85434701 |
| Molecular Formula | C30H29N3O |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | 4-methyl-N-(4-methylphenyl)-N-[4-[[oxiran-2-ylmethyl(phenyl)hydrazinylidene]methyl]phenyl]aniline |
| SMILES | Cc1ccc(N(c2ccc(C)cc2)c2ccc(C=NN(CC3CO3)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C30H29N3O/c1-23-8-14-27(15-9-23)33(28-16-10-24(2)11-17-28)29-18-12-25(13-19-29)20-31-32(21-30-22-34-30)26-6-4-3-5-7-26/h3-20,30H,21-22H2,1-2H3 |
| InChIKey | GVBSDBMJWHBPMI-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 31.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|