C22H22N2 — CID 53376390
N-benzyl-N-[(E)-benzylideneamino]-3,5-dimethylaniline (PubChem CID 53376390) has the molecular formula C22H22N2 and a molecular weight of 314.43 g/mol. Its IUPAC name is N-benzyl-N-[(E)-benzylideneamino]-3,5-dimethylaniline.
| Compound Name | N-benzyl-N-[(E)-benzylideneamino]-3,5-dimethylaniline |
|---|---|
| PubChem CID | 53376390 |
| Molecular Formula | C22H22N2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | N-benzyl-N-[(E)-benzylideneamino]-3,5-dimethylaniline |
| SMILES | Cc1cc(C)cc(N(Cc2ccccc2)/N=C/c2ccccc2)c1 |
| InChI | InChI=1S/C22H22N2/c1-18-13-19(2)15-22(14-18)24(17-21-11-7-4-8-12-21)23-16-20-9-5-3-6-10-20/h3-16H,17H2,1-2H3/b23-16+ |
| InChIKey | SCSFKMUQCSCWTN-XQNSMLJCSA-N |
| XLogP | 5.34 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|