C22H34N2O7 — CID 2750408
1-(3,7-dimethyloct-7-enyl)-1-phenylhydrazine;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 2750408) has the molecular formula C22H34N2O7 and a molecular weight of 438.52 g/mol. Its IUPAC name is 1-(3,7-dimethyloct-7-enyl)-1-phenylhydrazine;2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | 1-(3,7-dimethyloct-7-enyl)-1-phenylhydrazine;2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 2750408 |
| Molecular Formula | C22H34N2O7 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | 1-(3,7-dimethyloct-7-enyl)-1-phenylhydrazine;2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | C=C(C)CCCC(C)CCN(N)c1ccccc1.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C16H26N2.C6H8O7/c1-14(2)8-7-9-15(3)12-13-18(17)16-10-5-4-6-11-16;7-3(8)1-6(13,5(11)12)2-4(9)10/h4-6,10-11,15H,1,7-9,12-13,17H2,2-3H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | DASQAPSWBUGNGQ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 161.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|