C14H19NO7 — CID 57354248
3-carboxy-3,5-dihydroxy-5-oxopentanoate;1-phenylethylazanium (PubChem CID 57354248) has the molecular formula C14H19NO7 and a molecular weight of 313.31 g/mol. Its IUPAC name is 3-carboxy-3,5-dihydroxy-5-oxopentanoate;1-phenylethylazanium.
| Compound Name | 3-carboxy-3,5-dihydroxy-5-oxopentanoate;1-phenylethylazanium |
|---|---|
| PubChem CID | 57354248 |
| Molecular Formula | C14H19NO7 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 3-carboxy-3,5-dihydroxy-5-oxopentanoate;1-phenylethylazanium |
| SMILES | CC([NH3+])c1ccccc1.O=C([O-])CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C8H11N.C6H8O7/c1-7(9)8-5-3-2-4-6-8;7-3(8)1-6(13,5(11)12)2-4(9)10/h2-7H,9H2,1H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | PNCVNNDPBHXPTE-UHFFFAOYSA-N |
| XLogP | -1.59 |
| TPSA | 162.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |