C14H23N3O7 — CID 175048959
aniline;ethane-1,2-diamine;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 175048959) has the molecular formula C14H23N3O7 and a molecular weight of 345.35 g/mol. Its IUPAC name is aniline;ethane-1,2-diamine;2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | aniline;ethane-1,2-diamine;2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 175048959 |
| Molecular Formula | C14H23N3O7 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | aniline;ethane-1,2-diamine;2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | NCCN.Nc1ccccc1.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C6H7N.C6H8O7.C2H8N2/c7-6-4-2-1-3-5-6;7-3(8)1-6(13,5(11)12)2-4(9)10;3-1-2-4/h1-5H,7H2;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);1-4H2 |
| InChIKey | PDBQCHYUJKMMOP-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 210.19 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|