C19H21NO7 — CID 174408593
2-benzylaniline;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 174408593) has the molecular formula C19H21NO7 and a molecular weight of 375.38 g/mol. Its IUPAC name is 2-benzylaniline;2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | 2-benzylaniline;2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 174408593 |
| Molecular Formula | C19H21NO7 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 2-benzylaniline;2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | Nc1ccccc1Cc1ccccc1.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C13H13N.C6H8O7/c14-13-9-5-4-8-12(13)10-11-6-2-1-3-7-11;7-3(8)1-6(13,5(11)12)2-4(9)10/h1-9H,10,14H2;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | CWSIUYJXFZBCJC-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 158.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|