C6H8O8Zn — CID 155051192
zinc;2-hydroxypropane-1,2,3-tricarboxylic acid;oxygen(2-) (PubChem CID 155051192) has the molecular formula C6H8O8Zn and a molecular weight of 273.51 g/mol. Its IUPAC name is zinc;2-hydroxypropane-1,2,3-tricarboxylic acid;oxygen(2-).
| Compound Name | zinc;2-hydroxypropane-1,2,3-tricarboxylic acid;oxygen(2-) |
|---|---|
| PubChem CID | 155051192 |
| Molecular Formula | C6H8O8Zn |
| Molecular Weight | 273.51 g/mol |
| Exact Mass | 271.95 |
| IUPAC Name | zinc;2-hydroxypropane-1,2,3-tricarboxylic acid;oxygen(2-) |
| SMILES | O=C(O)CC(O)(CC(=O)O)C(=O)O.[O-2].[Zn+2] |
| InChI | InChI=1S/C6H8O7.O.Zn/c7-3(8)1-6(13,5(11)12)2-4(9)10;;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);;/q;-2;+2 |
| InChIKey | BOWMUFQFTPVGAR-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 160.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.51 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|