About acetic acid;2-benzylaniline
acetic acid;2-benzylaniline (PubChem CID 174872932) has the molecular formula C15H17NO2
and a molecular weight of 243.31 g/mol. Its IUPAC name is acetic acid;2-benzylaniline.
Molecular Properties
| Compound Name | acetic acid;2-benzylaniline |
| PubChem CID | 174872932 |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | acetic acid;2-benzylaniline |
| SMILES | CC(=O)O.Nc1ccccc1Cc1ccccc1 |
| InChI | InChI=1S/C13H13N.C2H4O2/c14-13-9-5-4-8-12(13)10-11-6-2-1-3-7-11;1-2(3)4/h1-9H,10,14H2;1H3,(H,3,4) |
| InChIKey | ZBTNCYOAGMASGO-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;2-benzylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;2-benzylaniline?
The IUPAC name of acetic acid;2-benzylaniline (CID 174872932) is acetic acid;2-benzylaniline.
What is the SMILES notation for acetic acid;2-benzylaniline?
The canonical SMILES for acetic acid;2-benzylaniline is CC(=O)O.Nc1ccccc1Cc1ccccc1.
What is the InChIKey of acetic acid;2-benzylaniline?
The InChIKey is ZBTNCYOAGMASGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N.C2H4O2/c14-13-9-5-4-8-12(13)10-11-6-2-1-3-7-11;1-2(3)4/h1-9H,10,14H2;1H3,(H,3,4).
What are the key properties of acetic acid;2-benzylaniline?
acetic acid;2-benzylaniline has a molecular weight of 243.31 g/mol, XLogP of 2.95, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;2-benzylaniline is sourced from PubChem (CID 174872932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).