C10H13NO8 — CID 53249398
furan-2-amine;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 53249398) has the molecular formula C10H13NO8 and a molecular weight of 275.21 g/mol. Its IUPAC name is furan-2-amine;2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | furan-2-amine;2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 53249398 |
| Molecular Formula | C10H13NO8 |
| Molecular Weight | 275.21 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | furan-2-amine;2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | Nc1ccco1.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C6H8O7.C4H5NO/c7-3(8)1-6(13,5(11)12)2-4(9)10;5-4-2-1-3-6-4/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);1-3H,5H2 |
| InChIKey | YQCULBGJCFTGRA-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 171.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.21 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |