C14H14O8 — CID 159235407
1-benzofuran;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 159235407) has the molecular formula C14H14O8 and a molecular weight of 310.26 g/mol. Its IUPAC name is 1-benzofuran;2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | 1-benzofuran;2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 159235407 |
| Molecular Formula | C14H14O8 |
| Molecular Weight | 310.26 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 1-benzofuran;2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | O=C(O)CC(O)(CC(=O)O)C(=O)O.c1ccc2occc2c1 |
| InChI | InChI=1S/C8H6O.C6H8O7/c1-2-4-8-7(3-1)5-6-9-8;7-3(8)1-6(13,5(11)12)2-4(9)10/h1-6H;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | KTKGUFYHWQXQCH-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 145.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.26 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |