About 1-benzofuran;toluene
1-benzofuran;toluene (PubChem CID 162139528) has the molecular formula C15H14O
and a molecular weight of 210.28 g/mol. Its IUPAC name is 1-benzofuran;toluene.
Molecular Properties
| Compound Name | 1-benzofuran;toluene |
| PubChem CID | 162139528 |
| Molecular Formula | C15H14O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 1-benzofuran;toluene |
| SMILES | Cc1ccccc1.c1ccc2occc2c1 |
| InChI | InChI=1S/C8H6O.C7H8/c1-2-4-8-7(3-1)5-6-9-8;1-7-5-3-2-4-6-7/h1-6H;2-6H,1H3 |
| InChIKey | ZJSYNMSYSYISBK-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-benzofuran;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzofuran;toluene?
The IUPAC name of 1-benzofuran;toluene (CID 162139528) is 1-benzofuran;toluene.
What is the SMILES notation for 1-benzofuran;toluene?
The canonical SMILES for 1-benzofuran;toluene is Cc1ccccc1.c1ccc2occc2c1.
What is the InChIKey of 1-benzofuran;toluene?
The InChIKey is ZJSYNMSYSYISBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O.C7H8/c1-2-4-8-7(3-1)5-6-9-8;1-7-5-3-2-4-6-7/h1-6H;2-6H,1H3.
What are the key properties of 1-benzofuran;toluene?
1-benzofuran;toluene has a molecular weight of 210.28 g/mol, XLogP of 4.43, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzofuran;toluene is sourced from PubChem (CID 162139528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).