About 3-tritio-1-benzofuran
3-tritio-1-benzofuran (PubChem CID 140580560) has the molecular formula C8H6O
and a molecular weight of 120.14 g/mol. Its IUPAC name is 3-tritio-1-benzofuran.
Molecular Properties
| Compound Name | 3-tritio-1-benzofuran |
| PubChem CID | 140580560 |
| Molecular Formula | C8H6O |
| Molecular Weight | 120.14 g/mol |
| Exact Mass | 120.05 |
| IUPAC Name | 3-tritio-1-benzofuran |
| SMILES | [3H]c1coc2ccccc12 |
| InChI | InChI=1S/C8H6O/c1-2-4-8-7(3-1)5-6-9-8/h1-6H/i5T |
| InChIKey | IANQTJSKSUMEQM-XHHURNKPSA-N |
| XLogP | 2.43 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.14 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-tritio-1-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tritio-1-benzofuran?
The IUPAC name of 3-tritio-1-benzofuran (CID 140580560) is 3-tritio-1-benzofuran.
What is the SMILES notation for 3-tritio-1-benzofuran?
The canonical SMILES for 3-tritio-1-benzofuran is [3H]c1coc2ccccc12.
What is the InChIKey of 3-tritio-1-benzofuran?
The InChIKey is IANQTJSKSUMEQM-XHHURNKPSA-N. The full InChI is InChI=1S/C8H6O/c1-2-4-8-7(3-1)5-6-9-8/h1-6H/i5T.
What are the key properties of 3-tritio-1-benzofuran?
3-tritio-1-benzofuran has a molecular weight of 120.14 g/mol, XLogP of 2.43, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tritio-1-benzofuran is sourced from PubChem (CID 140580560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).