About 1-benzofuran;1-chloro-4-phenylbenzene
1-benzofuran;1-chloro-4-phenylbenzene (PubChem CID 175596576) has the molecular formula C20H15ClO
and a molecular weight of 306.79 g/mol. Its IUPAC name is 1-benzofuran;1-chloro-4-phenylbenzene.
Molecular Properties
| Compound Name | 1-benzofuran;1-chloro-4-phenylbenzene |
| PubChem CID | 175596576 |
| Molecular Formula | C20H15ClO |
| Molecular Weight | 306.79 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 1-benzofuran;1-chloro-4-phenylbenzene |
| SMILES | Clc1ccc(-c2ccccc2)cc1.c1ccc2occc2c1 |
| InChI | InChI=1S/C12H9Cl.C8H6O/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10;1-2-4-8-7(3-1)5-6-9-8/h1-9H;1-6H |
| InChIKey | DGRKHCWXDVPLDQ-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 306.79 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-benzofuran;1-chloro-4-phenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzofuran;1-chloro-4-phenylbenzene?
The IUPAC name of 1-benzofuran;1-chloro-4-phenylbenzene (CID 175596576) is 1-benzofuran;1-chloro-4-phenylbenzene.
What is the SMILES notation for 1-benzofuran;1-chloro-4-phenylbenzene?
The canonical SMILES for 1-benzofuran;1-chloro-4-phenylbenzene is Clc1ccc(-c2ccccc2)cc1.c1ccc2occc2c1.
What is the InChIKey of 1-benzofuran;1-chloro-4-phenylbenzene?
The InChIKey is DGRKHCWXDVPLDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9Cl.C8H6O/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10;1-2-4-8-7(3-1)5-6-9-8/h1-9H;1-6H.
What are the key properties of 1-benzofuran;1-chloro-4-phenylbenzene?
1-benzofuran;1-chloro-4-phenylbenzene has a molecular weight of 306.79 g/mol, XLogP of 6.44, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzofuran;1-chloro-4-phenylbenzene is sourced from PubChem (CID 175596576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).