About 1-chloro-4-phenylbenzene;ethanamine
1-chloro-4-phenylbenzene;ethanamine (PubChem CID 174641678) has the molecular formula C16H23ClN2
and a molecular weight of 278.83 g/mol. Its IUPAC name is 1-chloro-4-phenylbenzene;ethanamine.
Molecular Properties
| Compound Name | 1-chloro-4-phenylbenzene;ethanamine |
| PubChem CID | 174641678 |
| Molecular Formula | C16H23ClN2 |
| Molecular Weight | 278.83 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 1-chloro-4-phenylbenzene;ethanamine |
| SMILES | CCN.CCN.Clc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H9Cl.2C2H7N/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10;2*1-2-3/h1-9H;2*2-3H2,1H3 |
| InChIKey | XGIHJNHAESRSCI-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.83 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-chloro-4-phenylbenzene;ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-4-phenylbenzene;ethanamine?
The IUPAC name of 1-chloro-4-phenylbenzene;ethanamine (CID 174641678) is 1-chloro-4-phenylbenzene;ethanamine.
What is the SMILES notation for 1-chloro-4-phenylbenzene;ethanamine?
The canonical SMILES for 1-chloro-4-phenylbenzene;ethanamine is CCN.CCN.Clc1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1-chloro-4-phenylbenzene;ethanamine?
The InChIKey is XGIHJNHAESRSCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9Cl.2C2H7N/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10;2*1-2-3/h1-9H;2*2-3H2,1H3.
What are the key properties of 1-chloro-4-phenylbenzene;ethanamine?
1-chloro-4-phenylbenzene;ethanamine has a molecular weight of 278.83 g/mol, XLogP of 3.94, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-4-phenylbenzene;ethanamine is sourced from PubChem (CID 174641678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).