C19H19Cl — CID 69123397
1-chloro-4-(4,4-dimethyl-2-phenylcyclopenten-1-yl)benzene (PubChem CID 69123397) has the molecular formula C19H19Cl and a molecular weight of 282.81 g/mol. Its IUPAC name is 1-chloro-4-(4,4-dimethyl-2-phenylcyclopenten-1-yl)benzene.
| Compound Name | 1-chloro-4-(4,4-dimethyl-2-phenylcyclopenten-1-yl)benzene |
|---|---|
| PubChem CID | 69123397 |
| Molecular Formula | C19H19Cl |
| Molecular Weight | 282.81 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 1-chloro-4-(4,4-dimethyl-2-phenylcyclopenten-1-yl)benzene |
| SMILES | CC1(C)CC(c2ccccc2)=C(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C19H19Cl/c1-19(2)12-17(14-6-4-3-5-7-14)18(13-19)15-8-10-16(20)11-9-15/h3-11H,12-13H2,1-2H3 |
| InChIKey | FYRYPRJESKKODJ-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.81 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|