About 5,5-dimethyl-2,3-diphenylcyclohex-2-en-1-one
5,5-dimethyl-2,3-diphenylcyclohex-2-en-1-one (PubChem CID 142736509) has the molecular formula C20H20O
and a molecular weight of 276.38 g/mol. Its IUPAC name is 5,5-dimethyl-2,3-diphenylcyclohex-2-en-1-one.
Molecular Properties
| Compound Name | 5,5-dimethyl-2,3-diphenylcyclohex-2-en-1-one |
| PubChem CID | 142736509 |
| Molecular Formula | C20H20O |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 5,5-dimethyl-2,3-diphenylcyclohex-2-en-1-one |
| SMILES | CC1(C)CC(=O)C(c2ccccc2)=C(c2ccccc2)C1 |
| InChI | InChI=1S/C20H20O/c1-20(2)13-17(15-9-5-3-6-10-15)19(18(21)14-20)16-11-7-4-8-12-16/h3-12H,13-14H2,1-2H3 |
| InChIKey | GTWIZKNFVNCICV-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 5,5-dimethyl-2,3-diphenylcyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethyl-2,3-diphenylcyclohex-2-en-1-one?
The IUPAC name of 5,5-dimethyl-2,3-diphenylcyclohex-2-en-1-one (CID 142736509) is 5,5-dimethyl-2,3-diphenylcyclohex-2-en-1-one.
What is the SMILES notation for 5,5-dimethyl-2,3-diphenylcyclohex-2-en-1-one?
The canonical SMILES for 5,5-dimethyl-2,3-diphenylcyclohex-2-en-1-one is CC1(C)CC(=O)C(c2ccccc2)=C(c2ccccc2)C1.
What is the InChIKey of 5,5-dimethyl-2,3-diphenylcyclohex-2-en-1-one?
The InChIKey is GTWIZKNFVNCICV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20O/c1-20(2)13-17(15-9-5-3-6-10-15)19(18(21)14-20)16-11-7-4-8-12-16/h3-12H,13-14H2,1-2H3.
What are the key properties of 5,5-dimethyl-2,3-diphenylcyclohex-2-en-1-one?
5,5-dimethyl-2,3-diphenylcyclohex-2-en-1-one has a molecular weight of 276.38 g/mol, XLogP of 4.99, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethyl-2,3-diphenylcyclohex-2-en-1-one is sourced from PubChem (CID 142736509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).