C16H22 — CID 59224827
(2-ethyl-4,4-dimethylcyclohexen-1-yl)benzene (PubChem CID 59224827) has the molecular formula C16H22 and a molecular weight of 214.35 g/mol. Its IUPAC name is (2-ethyl-4,4-dimethylcyclohexen-1-yl)benzene.
| Compound Name | (2-ethyl-4,4-dimethylcyclohexen-1-yl)benzene |
|---|---|
| PubChem CID | 59224827 |
| Molecular Formula | C16H22 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | (2-ethyl-4,4-dimethylcyclohexen-1-yl)benzene |
| SMILES | CCC1=C(c2ccccc2)CCC(C)(C)C1 |
| InChI | InChI=1S/C16H22/c1-4-13-12-16(2,3)11-10-15(13)14-8-6-5-7-9-14/h5-9H,4,10-12H2,1-3H3 |
| InChIKey | YLIPIDPWPJJFHJ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |